About 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one
5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one (PubChem CID 175556001) has the molecular formula C22H28N4O2
and a molecular weight of 380.49 g/mol. Its IUPAC name is 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one |
| PubChem CID | 175556001 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one |
| SMILES | CCn1c(=O)n(C)c2cc(Nc3ccc(N4CC(C)OC(C)C4)cc3)ccc21 |
| InChI | InChI=1S/C22H28N4O2/c1-5-26-20-11-8-18(12-21(20)24(4)22(26)27)23-17-6-9-19(10-7-17)25-13-15(2)28-16(3)14-25/h6-12,15-16,23H,5,13-14H2,1-4H3 |
| InChIKey | WJZUKRSKUGVRNY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one?
The IUPAC name of 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one (CID 175556001) is 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one.
What is the SMILES notation for 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one?
The canonical SMILES for 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one is CCn1c(=O)n(C)c2cc(Nc3ccc(N4CC(C)OC(C)C4)cc3)ccc21.
What is the InChIKey of 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one?
The InChIKey is WJZUKRSKUGVRNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O2/c1-5-26-20-11-8-18(12-21(20)24(4)22(26)27)23-17-6-9-19(10-7-17)25-13-15(2)28-16(3)14-25/h6-12,15-16,23H,5,13-14H2,1-4H3.
What are the key properties of 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one?
5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one has a molecular weight of 380.49 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-1-ethyl-3-methylbenzimidazol-2-one is sourced from PubChem (CID 175556001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).