About 2H-chromene;nickel;phosphane
2H-chromene;nickel;phosphane (PubChem CID 175556104) has the molecular formula C9H11NiOP
and a molecular weight of 224.85 g/mol. Its IUPAC name is 2H-chromene;nickel;phosphane.
Molecular Properties
| Compound Name | 2H-chromene;nickel;phosphane |
| PubChem CID | 175556104 |
| Molecular Formula | C9H11NiOP |
| Molecular Weight | 224.85 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 2H-chromene;nickel;phosphane |
| SMILES | C1=Cc2ccccc2OC1.P.[Ni] |
| InChI | InChI=1S/C9H8O.Ni.H3P/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-6H,7H2;;1H3 |
| InChIKey | RXPJCFDIEKZFTR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2H-chromene;nickel;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;nickel;phosphane?
The IUPAC name of 2H-chromene;nickel;phosphane (CID 175556104) is 2H-chromene;nickel;phosphane.
What is the SMILES notation for 2H-chromene;nickel;phosphane?
The canonical SMILES for 2H-chromene;nickel;phosphane is C1=Cc2ccccc2OC1.P.[Ni].
What is the InChIKey of 2H-chromene;nickel;phosphane?
The InChIKey is RXPJCFDIEKZFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.Ni.H3P/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-6H,7H2;;1H3.
What are the key properties of 2H-chromene;nickel;phosphane?
2H-chromene;nickel;phosphane has a molecular weight of 224.85 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;nickel;phosphane is sourced from PubChem (CID 175556104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).