C15H23N3O4S — CID 175556380
[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylcarbamoyl] 2-methylpropaneperoxoate (PubChem CID 175556380) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is [[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylcarbamoyl] 2-methylpropaneperoxoate.
| Compound Name | [[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylcarbamoyl] 2-methylpropaneperoxoate |
|---|---|
| PubChem CID | 175556380 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylcarbamoyl] 2-methylpropaneperoxoate |
| SMILES | CCCN(C(=O)OOC(=O)C(C)C)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C15H23N3O4S/c1-4-7-18(15(20)22-21-13(19)9(2)3)10-5-6-11-12(8-10)23-14(16)17-11/h9-10H,4-8H2,1-3H3,(H2,16,17)/t10-/m0/s1 |
| InChIKey | ZKORMGBZSBNWPR-JTQLQIEISA-N |
| XLogP | 2.55 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|