About 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid
1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid (PubChem CID 175556594) has the molecular formula C23H24N2O4
and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid |
| PubChem CID | 175556594 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid |
| SMILES | CCc1nn(-c2ccc(C=Cc3cc(OC)cc(OC)c3)cc2)c(C)c1C(=O)O |
| InChI | InChI=1S/C23H24N2O4/c1-5-21-22(23(26)27)15(2)25(24-21)18-10-8-16(9-11-18)6-7-17-12-19(28-3)14-20(13-17)29-4/h6-14H,5H2,1-4H3,(H,26,27) |
| InChIKey | BZXCMQIEGURPJG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid?
The IUPAC name of 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid (CID 175556594) is 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid?
The canonical SMILES for 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid is CCc1nn(-c2ccc(C=Cc3cc(OC)cc(OC)c3)cc2)c(C)c1C(=O)O.
What is the InChIKey of 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid?
The InChIKey is BZXCMQIEGURPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O4/c1-5-21-22(23(26)27)15(2)25(24-21)18-10-8-16(9-11-18)6-7-17-12-19(28-3)14-20(13-17)29-4/h6-14H,5H2,1-4H3,(H,26,27).
What are the key properties of 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid?
1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid has a molecular weight of 392.46 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-3-ethyl-5-methylpyrazole-4-carboxylic acid is sourced from PubChem (CID 175556594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).