C10H18N2O4 — CID 175556728
[1-(2-methoxyacetyl)piperidin-4-yl]methyl carbamate (PubChem CID 175556728) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is [1-(2-methoxyacetyl)piperidin-4-yl]methyl carbamate.
| Compound Name | [1-(2-methoxyacetyl)piperidin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 175556728 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [1-(2-methoxyacetyl)piperidin-4-yl]methyl carbamate |
| SMILES | COCC(=O)N1CCC(COC(N)=O)CC1 |
| InChI | InChI=1S/C10H18N2O4/c1-15-7-9(13)12-4-2-8(3-5-12)6-16-10(11)14/h8H,2-7H2,1H3,(H2,11,14) |
| InChIKey | SXBIHXHCLUFUDV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |