About 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine
2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine (PubChem CID 175556730) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine.
Analyze 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine?
The IUPAC name of 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine (CID 175556730) is 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine.
What is the SMILES notation for 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine?
The canonical SMILES for 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine is C=C1C=CC2=C(OCCCC2)O1.
What is the InChIKey of 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine?
The InChIKey is AXHIGHMXLOJHME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8-5-6-9-4-2-3-7-11-10(9)12-8/h5-6H,1-4,7H2.
What are the key properties of 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine?
2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine has a molecular weight of 164.20 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5,6,7,8-tetrahydropyrano[2,3-b]oxepine is sourced from PubChem (CID 175556730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).