C12H23F3O3Si — CID 175557319
3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,3,4-trifluorobutanoic acid (PubChem CID 175557319) has the molecular formula C12H23F3O3Si and a molecular weight of 300.39 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,3,4-trifluorobutanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,3,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 175557319 |
| Molecular Formula | C12H23F3O3Si |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-2,3,4-trifluorobutanoic acid |
| SMILES | CCC(F)(C(=O)O)C(F)(CF)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H23F3O3Si/c1-7-11(14,9(16)17)12(15,8-13)18-19(5,6)10(2,3)4/h7-8H2,1-6H3,(H,16,17) |
| InChIKey | ANDRCVYESBFYLH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|