About 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine
3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 175557663) has the molecular formula C23H30Cl2N4O2
and a molecular weight of 465.43 g/mol. Its IUPAC name is 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine |
| PubChem CID | 175557663 |
| Molecular Formula | C23H30Cl2N4O2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CN1CCN(CCCN)CC1.ClCOc1ccc2c(OCCl)c3ccccc3nc2c1 |
| InChI | InChI=1S/C15H11Cl2NO2.C8H19N3/c16-8-19-10-5-6-12-14(7-10)18-13-4-2-1-3-11(13)15(12)20-9-17;1-10-5-7-11(8-6-10)4-2-3-9/h1-7H,8-9H2;2-9H2,1H3 |
| InChIKey | HEIGRDMUOLYNEP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine?
The IUPAC name of 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine (CID 175557663) is 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine.
What is the SMILES notation for 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine?
The canonical SMILES for 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine is CN1CCN(CCCN)CC1.ClCOc1ccc2c(OCCl)c3ccccc3nc2c1.
What is the InChIKey of 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine?
The InChIKey is HEIGRDMUOLYNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO2.C8H19N3/c16-8-19-10-5-6-12-14(7-10)18-13-4-2-1-3-11(13)15(12)20-9-17;1-10-5-7-11(8-6-10)4-2-3-9/h1-7H,8-9H2;2-9H2,1H3.
What are the key properties of 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine?
3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine has a molecular weight of 465.43 g/mol, XLogP of 4.12, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-bis(chloromethoxy)acridine;3-(4-methylpiperazin-1-yl)propan-1-amine is sourced from PubChem (CID 175557663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).