About 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal
2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal (PubChem CID 175557680) has the molecular formula C19H38O5Si
and a molecular weight of 374.59 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal.
Molecular Properties
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal |
| PubChem CID | 175557680 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal |
| SMILES | COCOC(C=O)(O[Si](C)(C)C(C)(C)C)C(C)C=C(C)CC(C)OC |
| InChI | InChI=1S/C19H38O5Si/c1-15(12-17(3)22-8)11-16(2)19(13-20,23-14-21-7)24-25(9,10)18(4,5)6/h11,13,16-17H,12,14H2,1-10H3 |
| InChIKey | XCDNOYLUVLPJQR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal?
The IUPAC name of 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal (CID 175557680) is 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal.
What is the SMILES notation for 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal?
The canonical SMILES for 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal is COCOC(C=O)(O[Si](C)(C)C(C)(C)C)C(C)C=C(C)CC(C)OC.
What is the InChIKey of 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal?
The InChIKey is XCDNOYLUVLPJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O5Si/c1-15(12-17(3)22-8)11-16(2)19(13-20,23-14-21-7)24-25(9,10)18(4,5)6/h11,13,16-17H,12,14H2,1-10H3.
What are the key properties of 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal?
2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal has a molecular weight of 374.59 g/mol, XLogP of 4.53, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal is sourced from PubChem (CID 175557680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).