C25H52O6Si2 — CID 175557684
(E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal (PubChem CID 175557684) has the molecular formula C25H52O6Si2 and a molecular weight of 504.86 g/mol. Its IUPAC name is (E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal.
| Compound Name | (E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal |
|---|---|
| PubChem CID | 175557684 |
| Molecular Formula | C25H52O6Si2 |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | (E)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-methoxy-2-(methoxymethoxy)-3,5-dimethyloct-4-enal |
| SMILES | COCOC(C=O)C(C)/C=C(\C)C(O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C25H52O6Si2/c1-19(21(16-26)29-18-27-9)15-20(2)23(31-33(13,14)25(6,7)8)22(28-10)17-30-32(11,12)24(3,4)5/h15-16,19,21-23H,17-18H2,1-14H3/b20-15+ |
| InChIKey | NOBZQOBUZKPQPI-HMMYKYKNSA-N |
| XLogP | 6.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|