C7H15NO2 — CID 175557801
(4R)-N,N,2,2-tetramethyl-1,3-dioxolan-4-amine (PubChem CID 175557801) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (4R)-N,N,2,2-tetramethyl-1,3-dioxolan-4-amine.
| Compound Name | (4R)-N,N,2,2-tetramethyl-1,3-dioxolan-4-amine |
|---|---|
| PubChem CID | 175557801 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (4R)-N,N,2,2-tetramethyl-1,3-dioxolan-4-amine |
| SMILES | CN(C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C7H15NO2/c1-7(2)9-5-6(10-7)8(3)4/h6H,5H2,1-4H3/t6-/m1/s1 |
| InChIKey | JDCGAAMIIVQJGK-ZCFIWIBFSA-N |
| XLogP | 0.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |