About carbonochloridic acid;N,N-dimethylformamide
carbonochloridic acid;N,N-dimethylformamide (PubChem CID 175558395) has the molecular formula C4H8ClNO3
and a molecular weight of 153.56 g/mol. Its IUPAC name is carbonochloridic acid;N,N-dimethylformamide.
Molecular Properties
| Compound Name | carbonochloridic acid;N,N-dimethylformamide |
| PubChem CID | 175558395 |
| Molecular Formula | C4H8ClNO3 |
| Molecular Weight | 153.56 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | carbonochloridic acid;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=C(O)Cl |
| InChI | InChI=1S/C3H7NO.CHClO2/c1-4(2)3-5;2-1(3)4/h3H,1-2H3;(H,3,4) |
| InChIKey | MDQHWQJXASUXHU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze carbonochloridic acid;N,N-dimethylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonochloridic acid;N,N-dimethylformamide?
The IUPAC name of carbonochloridic acid;N,N-dimethylformamide (CID 175558395) is carbonochloridic acid;N,N-dimethylformamide.
What is the SMILES notation for carbonochloridic acid;N,N-dimethylformamide?
The canonical SMILES for carbonochloridic acid;N,N-dimethylformamide is CN(C)C=O.O=C(O)Cl.
What is the InChIKey of carbonochloridic acid;N,N-dimethylformamide?
The InChIKey is MDQHWQJXASUXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.CHClO2/c1-4(2)3-5;2-1(3)4/h3H,1-2H3;(H,3,4).
What are the key properties of carbonochloridic acid;N,N-dimethylformamide?
carbonochloridic acid;N,N-dimethylformamide has a molecular weight of 153.56 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonochloridic acid;N,N-dimethylformamide is sourced from PubChem (CID 175558395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).