About N-(4-methylphenyl)-1,2-oxazol-4-amine
N-(4-methylphenyl)-1,2-oxazol-4-amine (PubChem CID 175558512) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is N-(4-methylphenyl)-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-1,2-oxazol-4-amine |
| PubChem CID | 175558512 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-(4-methylphenyl)-1,2-oxazol-4-amine |
| SMILES | Cc1ccc(Nc2cnoc2)cc1 |
| InChI | InChI=1S/C10H10N2O/c1-8-2-4-9(5-3-8)12-10-6-11-13-7-10/h2-7,12H,1H3 |
| InChIKey | GWYQEDDAUMBZSX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-methylphenyl)-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-1,2-oxazol-4-amine?
The IUPAC name of N-(4-methylphenyl)-1,2-oxazol-4-amine (CID 175558512) is N-(4-methylphenyl)-1,2-oxazol-4-amine.
What is the SMILES notation for N-(4-methylphenyl)-1,2-oxazol-4-amine?
The canonical SMILES for N-(4-methylphenyl)-1,2-oxazol-4-amine is Cc1ccc(Nc2cnoc2)cc1.
What is the InChIKey of N-(4-methylphenyl)-1,2-oxazol-4-amine?
The InChIKey is GWYQEDDAUMBZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-8-2-4-9(5-3-8)12-10-6-11-13-7-10/h2-7,12H,1H3.
What are the key properties of N-(4-methylphenyl)-1,2-oxazol-4-amine?
N-(4-methylphenyl)-1,2-oxazol-4-amine has a molecular weight of 174.20 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-1,2-oxazol-4-amine is sourced from PubChem (CID 175558512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).