5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid

C13H21N3O2 — CID 175558823

IUPAC5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid
SMILESCC(C)(C)CCC(NCc1ccncn1)C(=O)O
InChIInChI=1S/C13H21N3O2/c1-13(2,3)6-4-11(12(17)18)15-8-10-5-7-14-9-16-10/h5,7,9,11,15H,4,6,8H2,1-3H3,(H,17,18)
InChIKeyVOOLTVNUFBGNBR-UHFFFAOYSA-N
MW251.33 g/mol
LogP1.85
Rot. Bonds6

About 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid

5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid (PubChem CID 175558823) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid.

Molecular Properties

Compound Name5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid
PubChem CID175558823
Molecular FormulaC13H21N3O2
Molecular Weight251.33 g/mol
Exact Mass251.16
IUPAC Name5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid
SMILESCC(C)(C)CCC(NCc1ccncn1)C(=O)O
InChIInChI=1S/C13H21N3O2/c1-13(2,3)6-4-11(12(17)18)15-8-10-5-7-14-9-16-10/h5,7,9,11,15H,4,6,8H2,1-3H3,(H,17,18)
InChIKeyVOOLTVNUFBGNBR-UHFFFAOYSA-N
XLogP1.85
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 51.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid?
The IUPAC name of 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid (CID 175558823) is 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid.
What is the SMILES notation for 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid?
The canonical SMILES for 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid is CC(C)(C)CCC(NCc1ccncn1)C(=O)O.
What is the InChIKey of 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid?
The InChIKey is VOOLTVNUFBGNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-13(2,3)6-4-11(12(17)18)15-8-10-5-7-14-9-16-10/h5,7,9,11,15H,4,6,8H2,1-3H3,(H,17,18).
What are the key properties of 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid?
5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid has a molecular weight of 251.33 g/mol, XLogP of 1.85, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-(pyrimidin-4-ylmethylamino)hexanoic acid is sourced from PubChem (CID 175558823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).