About spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene
spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene (PubChem CID 175559209) has the molecular formula C30H25NS
and a molecular weight of 431.60 g/mol. Its IUPAC name is spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene.
Molecular Properties
| Compound Name | spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene |
| PubChem CID | 175559209 |
| Molecular Formula | C30H25NS |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.C1=CC2(Cc3ccccc3N2)Sc2ccccc21 |
| InChI | InChI=1S/C16H13NS.C14H12/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10,17H,11H2;1-12H |
| InChIKey | VFURLGHZFFYULF-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene?
The IUPAC name of spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene (CID 175559209) is spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene.
What is the SMILES notation for spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene?
The canonical SMILES for spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene is C(=Cc1ccccc1)c1ccccc1.C1=CC2(Cc3ccccc3N2)Sc2ccccc21.
What is the InChIKey of spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene?
The InChIKey is VFURLGHZFFYULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NS.C14H12/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10,17H,11H2;1-12H.
What are the key properties of spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene?
spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene has a molecular weight of 431.60 g/mol, XLogP of 8.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dihydroindole-2,2'-thiochromene];stilbene is sourced from PubChem (CID 175559209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).