C5H6F6Si — CID 175559249
ethenyl(1,1,1,3,3,3-hexafluoropropan-2-yl)silane (PubChem CID 175559249) has the molecular formula C5H6F6Si and a molecular weight of 208.18 g/mol. Its IUPAC name is ethenyl(1,1,1,3,3,3-hexafluoropropan-2-yl)silane.
| Compound Name | ethenyl(1,1,1,3,3,3-hexafluoropropan-2-yl)silane |
|---|---|
| PubChem CID | 175559249 |
| Molecular Formula | C5H6F6Si |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | ethenyl(1,1,1,3,3,3-hexafluoropropan-2-yl)silane |
| SMILES | C=C[SiH2]C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6Si/c1-2-12-3(4(6,7)8)5(9,10)11/h2-3H,1,12H2 |
| InChIKey | LMNBSDORNKHNNU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|