About N-ethenyl-1,2,2-trifluoroethanamine
N-ethenyl-1,2,2-trifluoroethanamine (PubChem CID 175559672) has the molecular formula C4H6F3N
and a molecular weight of 125.09 g/mol. Its IUPAC name is N-ethenyl-1,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-ethenyl-1,2,2-trifluoroethanamine |
| PubChem CID | 175559672 |
| Molecular Formula | C4H6F3N |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | N-ethenyl-1,2,2-trifluoroethanamine |
| SMILES | C=CNC(F)C(F)F |
| InChI | InChI=1S/C4H6F3N/c1-2-8-4(7)3(5)6/h2-4,8H,1H2 |
| InChIKey | GJLMZFJZSOPKEC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-1,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-1,2,2-trifluoroethanamine?
The IUPAC name of N-ethenyl-1,2,2-trifluoroethanamine (CID 175559672) is N-ethenyl-1,2,2-trifluoroethanamine.
What is the SMILES notation for N-ethenyl-1,2,2-trifluoroethanamine?
The canonical SMILES for N-ethenyl-1,2,2-trifluoroethanamine is C=CNC(F)C(F)F.
What is the InChIKey of N-ethenyl-1,2,2-trifluoroethanamine?
The InChIKey is GJLMZFJZSOPKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F3N/c1-2-8-4(7)3(5)6/h2-4,8H,1H2.
What are the key properties of N-ethenyl-1,2,2-trifluoroethanamine?
N-ethenyl-1,2,2-trifluoroethanamine has a molecular weight of 125.09 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-1,2,2-trifluoroethanamine is sourced from PubChem (CID 175559672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).