About bis(1-benzofuran);naphthalen-1-ol
bis(1-benzofuran);naphthalen-1-ol (PubChem CID 175560201) has the molecular formula C26H20O3
and a molecular weight of 380.44 g/mol. Its IUPAC name is bis(1-benzofuran);naphthalen-1-ol.
Molecular Properties
| Compound Name | bis(1-benzofuran);naphthalen-1-ol |
| PubChem CID | 175560201 |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | bis(1-benzofuran);naphthalen-1-ol |
| SMILES | Oc1cccc2ccccc12.c1ccc2occc2c1.c1ccc2occc2c1 |
| InChI | InChI=1S/C10H8O.2C8H6O/c11-10-7-3-5-8-4-1-2-6-9(8)10;2*1-2-4-8-7(3-1)5-6-9-8/h1-7,11H;2*1-6H |
| InChIKey | IFGVOETUHOYLSZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(1-benzofuran);naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-benzofuran);naphthalen-1-ol?
The IUPAC name of bis(1-benzofuran);naphthalen-1-ol (CID 175560201) is bis(1-benzofuran);naphthalen-1-ol.
What is the SMILES notation for bis(1-benzofuran);naphthalen-1-ol?
The canonical SMILES for bis(1-benzofuran);naphthalen-1-ol is Oc1cccc2ccccc12.c1ccc2occc2c1.c1ccc2occc2c1.
What is the InChIKey of bis(1-benzofuran);naphthalen-1-ol?
The InChIKey is IFGVOETUHOYLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.2C8H6O/c11-10-7-3-5-8-4-1-2-6-9(8)10;2*1-2-4-8-7(3-1)5-6-9-8/h1-7,11H;2*1-6H.
What are the key properties of bis(1-benzofuran);naphthalen-1-ol?
bis(1-benzofuran);naphthalen-1-ol has a molecular weight of 380.44 g/mol, XLogP of 7.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-benzofuran);naphthalen-1-ol is sourced from PubChem (CID 175560201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).