About trilithium;benzene;1,3,5-triethylbenzene
trilithium;benzene;1,3,5-triethylbenzene (PubChem CID 175560263) has the molecular formula C18H21Li3
and a molecular weight of 258.19 g/mol. Its IUPAC name is trilithium;benzene;1,3,5-triethylbenzene.
Molecular Properties
| Compound Name | trilithium;benzene;1,3,5-triethylbenzene |
| PubChem CID | 175560263 |
| Molecular Formula | C18H21Li3 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | trilithium;benzene;1,3,5-triethylbenzene |
| SMILES | CCc1cc(CC)cc(CC)c1.[Li+].[Li+].[Li+].[c-]1c[c-]c[c-]c1 |
| InChI | InChI=1S/C12H18.C6H3.3Li/c1-4-10-7-11(5-2)9-12(6-3)8-10;1-2-4-6-5-3-1;;;/h7-9H,4-6H2,1-3H3;1,4-5H;;;/q;-3;3*+1 |
| InChIKey | CRBUEWICQPGURG-UHFFFAOYSA-N |
| XLogP | -4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze trilithium;benzene;1,3,5-triethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trilithium;benzene;1,3,5-triethylbenzene?
The IUPAC name of trilithium;benzene;1,3,5-triethylbenzene (CID 175560263) is trilithium;benzene;1,3,5-triethylbenzene.
What is the SMILES notation for trilithium;benzene;1,3,5-triethylbenzene?
The canonical SMILES for trilithium;benzene;1,3,5-triethylbenzene is CCc1cc(CC)cc(CC)c1.[Li+].[Li+].[Li+].[c-]1c[c-]c[c-]c1.
What is the InChIKey of trilithium;benzene;1,3,5-triethylbenzene?
The InChIKey is CRBUEWICQPGURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C6H3.3Li/c1-4-10-7-11(5-2)9-12(6-3)8-10;1-2-4-6-5-3-1;;;/h7-9H,4-6H2,1-3H3;1,4-5H;;;/q;-3;3*+1.
What are the key properties of trilithium;benzene;1,3,5-triethylbenzene?
trilithium;benzene;1,3,5-triethylbenzene has a molecular weight of 258.19 g/mol, XLogP of -4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trilithium;benzene;1,3,5-triethylbenzene is sourced from PubChem (CID 175560263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).