C27H40Br2ClFN4O2 — CID 175560592
(2S)-2-[[(2S)-8-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-N-[1-(2,5,5-trimethyl-4-oxohexan-2-yl)imidazol-4-yl]pentanamide;dihydrobromide (PubChem CID 175560592) has the molecular formula C27H40Br2ClFN4O2 and a molecular weight of 666.90 g/mol. Its IUPAC name is (2S)-2-[[(2S)-8-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-N-[1-(2,5,5-trimethyl-4-oxohexan-2-yl)imidazol-4-yl]pentanamide;dihydrobromide.
| Compound Name | (2S)-2-[[(2S)-8-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-N-[1-(2,5,5-trimethyl-4-oxohexan-2-yl)imidazol-4-yl]pentanamide;dihydrobromide |
|---|---|
| PubChem CID | 175560592 |
| Molecular Formula | C27H40Br2ClFN4O2 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 664.12 |
| IUPAC Name | (2S)-2-[[(2S)-8-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-N-[1-(2,5,5-trimethyl-4-oxohexan-2-yl)imidazol-4-yl]pentanamide;dihydrobromide |
| SMILES | Br.Br.CCC[C@H](N[C@H]1CCc2cc(F)cc(Cl)c2C1)C(=O)Nc1cn(C(C)(C)CC(=O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C27H38ClFN4O2.2BrH/c1-7-8-22(31-19-10-9-17-11-18(29)12-21(28)20(17)13-19)25(35)32-24-15-33(16-30-24)27(5,6)14-23(34)26(2,3)4;;/h11-12,15-16,19,22,31H,7-10,13-14H2,1-6H3,(H,32,35);2*1H/t19-,22-;;/m0../s1 |
| InChIKey | QBCUDUCGHXQSOX-VVJLZRNGSA-N |
| XLogP | 6.83 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |