C23H16ClF5N3O+ — CID 175560631
8-chloro-7-(2,6-difluorophenyl)-2-[(E)-2-ethoxyethenyl]-9-(trifluoromethyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium (PubChem CID 175560631) has the molecular formula C23H16ClF5N3O+ and a molecular weight of 480.84 g/mol. Its IUPAC name is 8-chloro-7-(2,6-difluorophenyl)-2-[(E)-2-ethoxyethenyl]-9-(trifluoromethyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium.
| Compound Name | 8-chloro-7-(2,6-difluorophenyl)-2-[(E)-2-ethoxyethenyl]-9-(trifluoromethyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium |
|---|---|
| PubChem CID | 175560631 |
| Molecular Formula | C23H16ClF5N3O+ |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 8-chloro-7-(2,6-difluorophenyl)-2-[(E)-2-ethoxyethenyl]-9-(trifluoromethyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium |
| SMILES | CCO/C=C/c1cnc2[n+](c1)-c1ccc(C(F)(F)F)c(Cl)c1C(c1c(F)cccc1F)=NC2 |
| InChI | InChI=1S/C23H16ClF5N3O/c1-2-33-9-8-13-10-30-18-11-31-22(19-15(25)4-3-5-16(19)26)20-17(32(18)12-13)7-6-14(21(20)24)23(27,28)29/h3-10,12H,2,11H2,1H3/q+1/b9-8+ |
| InChIKey | DUEDVLYIOMKOSW-CMDGGOBGSA-N |
| XLogP | 5.67 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|