C32H32ClN5O3S — CID 175560879
2,3-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide;hydrochloride (PubChem CID 175560879) has the molecular formula C32H32ClN5O3S and a molecular weight of 602.16 g/mol. Its IUPAC name is 2,3-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide;hydrochloride.
| Compound Name | 2,3-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 175560879 |
| Molecular Formula | C32H32ClN5O3S |
| Molecular Weight | 602.16 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 2,3-dimethyl-4-[5-(4-methylphenyl)sulfonyl-2-(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)pyrrolo[2,3-b]pyrazin-7-yl]benzamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc(C(N)=O)c(C)c3C)c3nc(-c4cc(C)c5c(c4)CCNC5)cnc32)cc1.Cl |
| InChI | InChI=1S/C32H31N5O3S.ClH/c1-18-5-7-24(8-6-18)41(39,40)37-17-28(25-9-10-26(31(33)38)21(4)20(25)3)30-32(37)35-16-29(36-30)23-13-19(2)27-15-34-12-11-22(27)14-23;/h5-10,13-14,16-17,34H,11-12,15H2,1-4H3,(H2,33,38);1H |
| InChIKey | IKDRQYFBFKOARX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.16 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |