About 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid
3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid (PubChem CID 175561025) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid |
| PubChem CID | 175561025 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid |
| SMILES | CC1C(=O)NC=CN1C(=O)O |
| InChI | InChI=1S/C6H8N2O3/c1-4-5(9)7-2-3-8(4)6(10)11/h2-4H,1H3,(H,7,9)(H,10,11) |
| InChIKey | INJLKBBFSIWEKZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
The IUPAC name of 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid (CID 175561025) is 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid.
What is the SMILES notation for 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
The canonical SMILES for 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid is CC1C(=O)NC=CN1C(=O)O.
What is the InChIKey of 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
The InChIKey is INJLKBBFSIWEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-4-5(9)7-2-3-8(4)6(10)11/h2-4H,1H3,(H,7,9)(H,10,11).
What are the key properties of 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid?
3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-oxo-1,3-dihydropyrazine-4-carboxylic acid is sourced from PubChem (CID 175561025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).