C22H37O3P — CID 175561063
4-(2,4-ditert-butylphenyl)-2-hydroxy-1,3-dioxa-2-phosphacycloundecane (PubChem CID 175561063) has the molecular formula C22H37O3P and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-(2,4-ditert-butylphenyl)-2-hydroxy-1,3-dioxa-2-phosphacycloundecane.
| Compound Name | 4-(2,4-ditert-butylphenyl)-2-hydroxy-1,3-dioxa-2-phosphacycloundecane |
|---|---|
| PubChem CID | 175561063 |
| Molecular Formula | C22H37O3P |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 4-(2,4-ditert-butylphenyl)-2-hydroxy-1,3-dioxa-2-phosphacycloundecane |
| SMILES | CC(C)(C)c1ccc(C2CCCCCCCOP(O)O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H37O3P/c1-21(2,3)17-13-14-18(19(16-17)22(4,5)6)20-12-10-8-7-9-11-15-24-26(23)25-20/h13-14,16,20,23H,7-12,15H2,1-6H3 |
| InChIKey | LKBKYNAGTJQTPI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|