About 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline
1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline (PubChem CID 175561101) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline.
Molecular Properties
| Compound Name | 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline |
| PubChem CID | 175561101 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline |
| SMILES | Cc1ccc(N)cc1.O=C1C=CC(=O)N1c1ccccc1O |
| InChI | InChI=1S/C10H7NO3.C7H9N/c12-8-4-2-1-3-7(8)11-9(13)5-6-10(11)14;1-6-2-4-7(8)5-3-6/h1-6,12H;2-5H,8H2,1H3 |
| InChIKey | BWEKVNUNCVVSAP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline?
The IUPAC name of 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline (CID 175561101) is 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline.
What is the SMILES notation for 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline?
The canonical SMILES for 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline is Cc1ccc(N)cc1.O=C1C=CC(=O)N1c1ccccc1O.
What is the InChIKey of 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline?
The InChIKey is BWEKVNUNCVVSAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3.C7H9N/c12-8-4-2-1-3-7(8)11-9(13)5-6-10(11)14;1-6-2-4-7(8)5-3-6/h1-6,12H;2-5H,8H2,1H3.
What are the key properties of 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline?
1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline has a molecular weight of 296.33 g/mol, XLogP of 2.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyphenyl)pyrrole-2,5-dione;4-methylaniline is sourced from PubChem (CID 175561101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).