C27H35N7O — CID 175561645
2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-9-methyl-7-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 175561645) has the molecular formula C27H35N7O and a molecular weight of 473.63 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-9-methyl-7-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-9-methyl-7-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 175561645 |
| Molecular Formula | C27H35N7O |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 2-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-9-methyl-7-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cn2nc(-c3cc(=O)n4cc(N(C)C5CCN(C)C(C)(C)C5C)cc(C)c4n3)cc2c(C)n1 |
| InChI | InChI=1S/C27H35N7O/c1-16-11-20(32(8)23-9-10-31(7)27(5,6)18(23)3)15-33-25(35)13-21(29-26(16)33)22-12-24-19(4)28-17(2)14-34(24)30-22/h11-15,18,23H,9-10H2,1-8H3 |
| InChIKey | WKQVNZAXXFHMNQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |