About 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole
2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole (PubChem CID 175561793) has the molecular formula C24H42N2O4Si2
and a molecular weight of 478.78 g/mol. Its IUPAC name is 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole.
Molecular Properties
| Compound Name | 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole |
| PubChem CID | 175561793 |
| Molecular Formula | C24H42N2O4Si2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole |
| SMILES | CC(C(=O)O)c1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1.c1c[nH]cn1 |
| InChI | InChI=1S/C21H38O4Si2.C3H4N2/c1-15(19(22)23)16-12-13-17(24-26(8,9)20(2,3)4)18(14-16)25-27(10,11)21(5,6)7;1-2-5-3-4-1/h12-15H,1-11H3,(H,22,23);1-3H,(H,4,5) |
| InChIKey | KHURNTBNJHBXPH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole?
The IUPAC name of 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole (CID 175561793) is 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole.
What is the SMILES notation for 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole?
The canonical SMILES for 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole is CC(C(=O)O)c1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1.c1c[nH]cn1.
What is the InChIKey of 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole?
The InChIKey is KHURNTBNJHBXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O4Si2.C3H4N2/c1-15(19(22)23)16-12-13-17(24-26(8,9)20(2,3)4)18(14-16)25-27(10,11)21(5,6)7;1-2-5-3-4-1/h12-15H,1-11H3,(H,22,23);1-3H,(H,4,5).
What are the key properties of 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole?
2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole has a molecular weight of 478.78 g/mol, XLogP of 7.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole is sourced from PubChem (CID 175561793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).