C24H42N2O4Si2 — CID 175561833
3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole (PubChem CID 175561833) has the molecular formula C24H42N2O4Si2 and a molecular weight of 478.78 g/mol. Its IUPAC name is 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole.
| Compound Name | 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole |
|---|---|
| PubChem CID | 175561833 |
| Molecular Formula | C24H42N2O4Si2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid;1H-imidazole |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCC(=O)O)cc1O[Si](C)(C)C(C)(C)C.c1c[nH]cn1 |
| InChI | InChI=1S/C21H38O4Si2.C3H4N2/c1-20(2,3)26(7,8)24-17-13-11-16(12-14-19(22)23)15-18(17)25-27(9,10)21(4,5)6;1-2-5-3-4-1/h11,13,15H,12,14H2,1-10H3,(H,22,23);1-3H,(H,4,5) |
| InChIKey | QDCKQQBERXCTBU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|