C19H16O2 — CID 175561918
2-(4-methylphenyl)-2,3,6,7-tetrahydro-s-indacene-1,5-dione (PubChem CID 175561918) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2,3,6,7-tetrahydro-s-indacene-1,5-dione.
| Compound Name | 2-(4-methylphenyl)-2,3,6,7-tetrahydro-s-indacene-1,5-dione |
|---|---|
| PubChem CID | 175561918 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(4-methylphenyl)-2,3,6,7-tetrahydro-s-indacene-1,5-dione |
| SMILES | Cc1ccc(C2Cc3cc4c(cc3C2=O)CCC4=O)cc1 |
| InChI | InChI=1S/C19H16O2/c1-11-2-4-12(5-3-11)16-10-14-9-15-13(6-7-18(15)20)8-17(14)19(16)21/h2-5,8-9,16H,6-7,10H2,1H3 |
| InChIKey | VLAZORUXJQKTNG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |