About [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate
[4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate (PubChem CID 175562214) has the molecular formula C22H34N2O2
and a molecular weight of 358.53 g/mol. Its IUPAC name is [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate.
Molecular Properties
| Compound Name | [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate |
| PubChem CID | 175562214 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate |
| SMILES | CC1(C)CCC(c2ccc(NC3CCC(COC(N)=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-22(2)13-11-18(12-14-22)17-5-9-20(10-6-17)24-19-7-3-16(4-8-19)15-26-21(23)25/h5-6,9-10,16,18-19,24H,3-4,7-8,11-15H2,1-2H3,(H2,23,25) |
| InChIKey | ZXRNPUIVRLEFGS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate?
The IUPAC name of [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate (CID 175562214) is [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate.
What is the SMILES notation for [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate?
The canonical SMILES for [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate is CC1(C)CCC(c2ccc(NC3CCC(COC(N)=O)CC3)cc2)CC1.
What is the InChIKey of [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate?
The InChIKey is ZXRNPUIVRLEFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2O2/c1-22(2)13-11-18(12-14-22)17-5-9-20(10-6-17)24-19-7-3-16(4-8-19)15-26-21(23)25/h5-6,9-10,16,18-19,24H,3-4,7-8,11-15H2,1-2H3,(H2,23,25).
What are the key properties of [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate?
[4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate has a molecular weight of 358.53 g/mol, XLogP of 5.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4,4-dimethylcyclohexyl)anilino]cyclohexyl]methyl carbamate is sourced from PubChem (CID 175562214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).