About 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine
1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine (PubChem CID 175562234) has the molecular formula C18H28FN3O
and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine |
| PubChem CID | 175562234 |
| Molecular Formula | C18H28FN3O |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine |
| SMILES | CC1CN(c2ccc(C3(N)CCC(N)CC3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C18H28FN3O/c1-12-10-22(11-13(2)23-12)17-4-3-14(9-16(17)19)18(21)7-5-15(20)6-8-18/h3-4,9,12-13,15H,5-8,10-11,20-21H2,1-2H3 |
| InChIKey | ZYXXVUFTSANORB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine?
The IUPAC name of 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine (CID 175562234) is 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine.
What is the SMILES notation for 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine?
The canonical SMILES for 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine is CC1CN(c2ccc(C3(N)CCC(N)CC3)cc2F)CC(C)O1.
What is the InChIKey of 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine?
The InChIKey is ZYXXVUFTSANORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28FN3O/c1-12-10-22(11-13(2)23-12)17-4-3-14(9-16(17)19)18(21)7-5-15(20)6-8-18/h3-4,9,12-13,15H,5-8,10-11,20-21H2,1-2H3.
What are the key properties of 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine?
1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine has a molecular weight of 321.44 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]cyclohexane-1,4-diamine is sourced from PubChem (CID 175562234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).