C8H15N3 — CID 175562486
1,2,4,5,6-pentamethyltriazine (PubChem CID 175562486) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1,2,4,5,6-pentamethyltriazine.
| Compound Name | 1,2,4,5,6-pentamethyltriazine |
|---|---|
| PubChem CID | 175562486 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1,2,4,5,6-pentamethyltriazine |
| SMILES | CC1=NN(C)N(C)C(C)=C1C |
| InChI | InChI=1S/C8H15N3/c1-6-7(2)9-11(5)10(4)8(6)3/h1-5H3 |
| InChIKey | XIWWBUHTHAJYDU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |