C23H21ClN3NaO5 — CID 175562722
sodium 3-[[[3-(2-chlorophenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate (PubChem CID 175562722) has the molecular formula C23H21ClN3NaO5 and a molecular weight of 477.88 g/mol. Its IUPAC name is sodium 3-[[[3-(2-chlorophenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate.
| Compound Name | sodium 3-[[[3-(2-chlorophenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 175562722 |
| Molecular Formula | C23H21ClN3NaO5 |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | sodium 3-[[[3-(2-chlorophenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate |
| SMILES | CC1=CN(C)C(=O)C(N(C(=O)NCCC(=O)[O-])c2cccc(-c3ccccc3Cl)c2)C1=O.[Na+] |
| InChI | InChI=1S/C23H22ClN3O5.Na/c1-14-13-26(2)22(31)20(21(14)30)27(23(32)25-11-10-19(28)29)16-7-5-6-15(12-16)17-8-3-4-9-18(17)24;/h3-9,12-13,20H,10-11H2,1-2H3,(H,25,32)(H,28,29);/q;+1/p-1 |
| InChIKey | NSEYBQNVSWGSQB-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|