C19H18ClNO9 — CID 175563766
[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl 4-chlorobenzoate (PubChem CID 175563766) has the molecular formula C19H18ClNO9 and a molecular weight of 439.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 175563766 |
| Molecular Formula | C19H18ClNO9 |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl 4-chlorobenzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](Oc2ccc([N+](=O)[O-])cc2)[C@H](O)[C@@H](O)[C@H]1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClNO9/c20-11-3-1-10(2-4-11)18(25)28-9-14-15(22)16(23)17(24)19(30-14)29-13-7-5-12(6-8-13)21(26)27/h1-8,14-17,19,22-24H,9H2/t14-,15+,16+,17-,19-/m1/s1 |
| InChIKey | SFZRTGRMBQULDU-DIKXUDHVSA-N |
| XLogP | 1.29 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|