C23H17FN2O5S2 — CID 175564373
4-[4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-sulfinoamino]-3-methoxyphenyl]benzoic acid (PubChem CID 175564373) has the molecular formula C23H17FN2O5S2 and a molecular weight of 484.53 g/mol. Its IUPAC name is 4-[4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-sulfinoamino]-3-methoxyphenyl]benzoic acid.
| Compound Name | 4-[4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-sulfinoamino]-3-methoxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 175564373 |
| Molecular Formula | C23H17FN2O5S2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 4-[4-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-sulfinoamino]-3-methoxyphenyl]benzoic acid |
| SMILES | COc1cc(-c2ccc(C(=O)O)cc2)ccc1N(c1cnc(-c2ccc(F)cc2)s1)S(=O)O |
| InChI | InChI=1S/C23H17FN2O5S2/c1-31-20-12-17(14-2-4-16(5-3-14)23(27)28)8-11-19(20)26(33(29)30)21-13-25-22(32-21)15-6-9-18(24)10-7-15/h2-13H,1H3,(H,27,28)(H,29,30) |
| InChIKey | DKATVXNNVICUFZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|