C32H27F8N3O4 — CID 175564565
2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]naphthalen-1-yl]propanoic acid (PubChem CID 175564565) has the molecular formula C32H27F8N3O4 and a molecular weight of 669.57 g/mol. Its IUPAC name is 2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]naphthalen-1-yl]propanoic acid.
| Compound Name | 2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 175564565 |
| Molecular Formula | C32H27F8N3O4 |
| Molecular Weight | 669.57 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | 2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[4-[1,6-dimethyl-2-oxo-4-(trifluoromethyl)-3-pyridinyl]naphthalen-1-yl]propanoic acid |
| SMILES | Cc1cc(C(F)(F)F)c(-c2ccc(CC(NC(=O)c3c(F)cc(NC(CCF)C(F)F)cc3F)C(=O)O)c3ccccc23)c(=O)n1C |
| InChI | InChI=1S/C32H27F8N3O4/c1-15-11-21(32(38,39)40)26(30(45)43(15)2)20-8-7-16(18-5-3-4-6-19(18)20)12-25(31(46)47)42-29(44)27-22(34)13-17(14-23(27)35)41-24(9-10-33)28(36)37/h3-8,11,13-14,24-25,28,41H,9-10,12H2,1-2H3,(H,42,44)(H,46,47) |
| InChIKey | UJCVNKJCNXPMQG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |