C29H31BF5N3O5 — CID 175564578
2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]propanoic acid (PubChem CID 175564578) has the molecular formula C29H31BF5N3O5 and a molecular weight of 607.39 g/mol. Its IUPAC name is 2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]propanoic acid.
| Compound Name | 2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 175564578 |
| Molecular Formula | C29H31BF5N3O5 |
| Molecular Weight | 607.39 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 2-[[2,6-difluoro-4-(1,1,4-trifluorobutan-2-ylamino)benzoyl]amino]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]propanoic acid |
| SMILES | CC1(C)OB(c2ccc(CC(NC(=O)c3c(F)cc(NC(CCF)C(F)F)cc3F)C(=O)O)c3ncccc23)OC1(C)C |
| InChI | InChI=1S/C29H31BF5N3O5/c1-28(2)29(3,4)43-30(42-28)18-8-7-15(24-17(18)6-5-11-36-24)12-22(27(40)41)38-26(39)23-19(32)13-16(14-20(23)33)37-21(9-10-31)25(34)35/h5-8,11,13-14,21-22,25,37H,9-10,12H2,1-4H3,(H,38,39)(H,40,41) |
| InChIKey | DTRGVHHNUPGFBZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|