C35H27F2N6O7S- — CID 175564582
8-[2-carboxy-2-[[2,6-difluoro-4-[N-sulfinato-4-(1,2,4-triazol-1-yl)anilino]benzoyl]amino]ethyl]-5-(2,6-dimethoxyphenyl)isoquinoline (PubChem CID 175564582) has the molecular formula C35H27F2N6O7S- and a molecular weight of 713.70 g/mol. Its IUPAC name is 8-[2-carboxy-2-[[2,6-difluoro-4-[N-sulfinato-4-(1,2,4-triazol-1-yl)anilino]benzoyl]amino]ethyl]-5-(2,6-dimethoxyphenyl)isoquinoline.
| Compound Name | 8-[2-carboxy-2-[[2,6-difluoro-4-[N-sulfinato-4-(1,2,4-triazol-1-yl)anilino]benzoyl]amino]ethyl]-5-(2,6-dimethoxyphenyl)isoquinoline |
|---|---|
| PubChem CID | 175564582 |
| Molecular Formula | C35H27F2N6O7S- |
| Molecular Weight | 713.70 g/mol |
| Exact Mass | 713.16 |
| IUPAC Name | 8-[2-carboxy-2-[[2,6-difluoro-4-[N-sulfinato-4-(1,2,4-triazol-1-yl)anilino]benzoyl]amino]ethyl]-5-(2,6-dimethoxyphenyl)isoquinoline |
| SMILES | COc1cccc(OC)c1-c1ccc(CC(NC(=O)c2c(F)cc(N(c3ccc(-n4cncn4)cc3)S(=O)[O-])cc2F)C(=O)O)c2cnccc12 |
| InChI | InChI=1S/C35H28F2N6O7S/c1-49-30-4-3-5-31(50-2)32(30)25-11-6-20(26-17-38-13-12-24(25)26)14-29(35(45)46)41-34(44)33-27(36)15-23(16-28(33)37)43(51(47)48)22-9-7-21(8-10-22)42-19-39-18-40-42/h3-13,15-19,29H,14H2,1-2H3,(H,41,44)(H,45,46)(H,47,48)/p-1 |
| InChIKey | JSDOGFZBHZGQLO-UHFFFAOYSA-M |
| XLogP | 5.14 |
| TPSA | 171.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|