C15H18F3N3O — CID 175565381
N-(3,3-difluorocyclobutyl)-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide (PubChem CID 175565381) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide.
| Compound Name | N-(3,3-difluorocyclobutyl)-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 175565381 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide |
| SMILES | O=C(NC1CC(F)(F)C1)C1=CC=C(C2=CCNCC2)C(F)N1 |
| InChI | InChI=1S/C15H18F3N3O/c16-13-11(9-3-5-19-6-4-9)1-2-12(21-13)14(22)20-10-7-15(17,18)8-10/h1-3,10,13,19,21H,4-8H2,(H,20,22) |
| InChIKey | GXIVWIYXKWYGIF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|