C28H31N3O6S — CID 175565722
ethyl 2-[1-[5-(2,4-dioxo-1,3-diazinan-1-yl)naphthalen-2-yl]piperidin-4-yl]oxy-4-methylbenzenesulfonate (PubChem CID 175565722) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is ethyl 2-[1-[5-(2,4-dioxo-1,3-diazinan-1-yl)naphthalen-2-yl]piperidin-4-yl]oxy-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-[1-[5-(2,4-dioxo-1,3-diazinan-1-yl)naphthalen-2-yl]piperidin-4-yl]oxy-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175565722 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | ethyl 2-[1-[5-(2,4-dioxo-1,3-diazinan-1-yl)naphthalen-2-yl]piperidin-4-yl]oxy-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1OC1CCN(c2ccc3c(N4CCC(=O)NC4=O)cccc3c2)CC1 |
| InChI | InChI=1S/C28H31N3O6S/c1-3-36-38(34,35)26-10-7-19(2)17-25(26)37-22-11-14-30(15-12-22)21-8-9-23-20(18-21)5-4-6-24(23)31-16-13-27(32)29-28(31)33/h4-10,17-18,22H,3,11-16H2,1-2H3,(H,29,32,33) |
| InChIKey | TXMDAEAYSBBEKG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|