5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid

C7H6F3NO3 — CID 175566101

IUPAC5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(CC(F)C(F)F)on1
InChIInChI=1S/C7H6F3NO3/c8-4(6(9)10)1-3-2-5(7(12)13)11-14-3/h2,4,6H,1H2,(H,12,13)
InChIKeyNHGHQNAEFGPUCF-UHFFFAOYSA-N
MW209.12 g/mol
LogP1.52
Rot. Bonds4

About 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid

5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 175566101) has the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. Its IUPAC name is 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid
PubChem CID175566101
Molecular FormulaC7H6F3NO3
Molecular Weight209.12 g/mol
Exact Mass209.03
IUPAC Name5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(CC(F)C(F)F)on1
InChIInChI=1S/C7H6F3NO3/c8-4(6(9)10)1-3-2-5(7(12)13)11-14-3/h2,4,6H,1H2,(H,12,13)
InChIKeyNHGHQNAEFGPUCF-UHFFFAOYSA-N
XLogP1.52
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.12
LogP ≤ 51.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid (CID 175566101) is 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(CC(F)C(F)F)on1.
What is the InChIKey of 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is NHGHQNAEFGPUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO3/c8-4(6(9)10)1-3-2-5(7(12)13)11-14-3/h2,4,6H,1H2,(H,12,13).
What are the key properties of 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid?
5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 209.12 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3,3-trifluoropropyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 175566101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).