About 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol
4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol (PubChem CID 175566375) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol.
Molecular Properties
| Compound Name | 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
| PubChem CID | 175566375 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
| SMILES | COC(C)Cc1cc2c(cc1O)O2 |
| InChI | InChI=1S/C10H12O3/c1-6(12-2)3-7-4-9-10(13-9)5-8(7)11/h4-6,11H,3H2,1-2H3 |
| InChIKey | FZYJEFXOTSLTSM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol?
The IUPAC name of 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol (CID 175566375) is 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol.
What is the SMILES notation for 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol?
The canonical SMILES for 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol is COC(C)Cc1cc2c(cc1O)O2.
What is the InChIKey of 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol?
The InChIKey is FZYJEFXOTSLTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6(12-2)3-7-4-9-10(13-9)5-8(7)11/h4-6,11H,3H2,1-2H3.
What are the key properties of 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol?
4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol has a molecular weight of 180.20 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxypropyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol is sourced from PubChem (CID 175566375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).