About (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate
(pyridin-2-yldisulfanyl) 2-methylpent-2-enoate (PubChem CID 175566398) has the molecular formula C11H13NO2S2
and a molecular weight of 255.36 g/mol. Its IUPAC name is (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate.
Molecular Properties
| Compound Name | (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate |
| PubChem CID | 175566398 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate |
| SMILES | CCC=C(C)C(=O)OSSc1ccccn1 |
| InChI | InChI=1S/C11H13NO2S2/c1-3-6-9(2)11(13)14-16-15-10-7-4-5-8-12-10/h4-8H,3H2,1-2H3 |
| InChIKey | HLRFJNOCIUNWBD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate?
The IUPAC name of (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate (CID 175566398) is (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate.
What is the SMILES notation for (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate?
The canonical SMILES for (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate is CCC=C(C)C(=O)OSSc1ccccn1.
What is the InChIKey of (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate?
The InChIKey is HLRFJNOCIUNWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S2/c1-3-6-9(2)11(13)14-16-15-10-7-4-5-8-12-10/h4-8H,3H2,1-2H3.
What are the key properties of (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate?
(pyridin-2-yldisulfanyl) 2-methylpent-2-enoate has a molecular weight of 255.36 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (pyridin-2-yldisulfanyl) 2-methylpent-2-enoate is sourced from PubChem (CID 175566398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).