C21H25FN6O4 — CID 175566541
2-[[5-[[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-methylpropyl]carbamoylamino]pyrimidin-2-yl]amino]ethyl carbamate (PubChem CID 175566541) has the molecular formula C21H25FN6O4 and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[[5-[[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-methylpropyl]carbamoylamino]pyrimidin-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[5-[[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-methylpropyl]carbamoylamino]pyrimidin-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 175566541 |
| Molecular Formula | C21H25FN6O4 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[[5-[[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)-2-methylpropyl]carbamoylamino]pyrimidin-2-yl]amino]ethyl carbamate |
| SMILES | Cc1c(C(NC(=O)Nc2cnc(NCCOC(N)=O)nc2)C(C)C)oc2ccc(F)cc12 |
| InChI | InChI=1S/C21H25FN6O4/c1-11(2)17(18-12(3)15-8-13(22)4-5-16(15)32-18)28-21(30)27-14-9-25-20(26-10-14)24-6-7-31-19(23)29/h4-5,8-11,17H,6-7H2,1-3H3,(H2,23,29)(H,24,25,26)(H2,27,28,30) |
| InChIKey | VANCXAMQWCUOKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|