C16H12F5N5O2 — CID 175566619
1-(2-aminopyrimidin-5-yl)-3-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-1,2,2-trifluoroethyl]urea (PubChem CID 175566619) has the molecular formula C16H12F5N5O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 1-(2-aminopyrimidin-5-yl)-3-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-1,2,2-trifluoroethyl]urea.
| Compound Name | 1-(2-aminopyrimidin-5-yl)-3-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-1,2,2-trifluoroethyl]urea |
|---|---|
| PubChem CID | 175566619 |
| Molecular Formula | C16H12F5N5O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 1-(2-aminopyrimidin-5-yl)-3-[1-(5,7-difluoro-3-methyl-1-benzofuran-2-yl)-1,2,2-trifluoroethyl]urea |
| SMILES | Cc1c(C(F)(NC(=O)Nc2cnc(N)nc2)C(F)F)oc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C16H12F5N5O2/c1-6-9-2-7(17)3-10(18)11(9)28-12(6)16(21,13(19)20)26-15(27)25-8-4-23-14(22)24-5-8/h2-5,13H,1H3,(H2,22,23,24)(H2,25,26,27) |
| InChIKey | FCOZHCVTTHASNG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|