About 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one
6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 175567102) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one.
Molecular Properties
| Compound Name | 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one |
| PubChem CID | 175567102 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | CC(N)c1ccc(Cc2ccc3c(c2)C(=O)OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-12(20)15-7-4-13(5-8-15)10-14-6-9-17-16(11-14)18(21)23-19(2,3)22-17/h4-9,11-12H,10,20H2,1-3H3 |
| InChIKey | OYLXPSNYCAITAW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one?
The IUPAC name of 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one (CID 175567102) is 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one.
What is the SMILES notation for 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one?
The canonical SMILES for 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one is CC(N)c1ccc(Cc2ccc3c(c2)C(=O)OC(C)(C)O3)cc1.
What is the InChIKey of 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one?
The InChIKey is OYLXPSNYCAITAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-12(20)15-7-4-13(5-8-15)10-14-6-9-17-16(11-14)18(21)23-19(2,3)22-17/h4-9,11-12H,10,20H2,1-3H3.
What are the key properties of 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one?
6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one has a molecular weight of 311.38 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(1-aminoethyl)phenyl]methyl]-2,2-dimethyl-1,3-benzodioxin-4-one is sourced from PubChem (CID 175567102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).