C15H27NO9 — CID 175567288
butan-2-yl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate (PubChem CID 175567288) has the molecular formula C15H27NO9 and a molecular weight of 365.38 g/mol. Its IUPAC name is butan-2-yl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate.
| Compound Name | butan-2-yl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 175567288 |
| Molecular Formula | C15H27NO9 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | butan-2-yl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate |
| SMILES | CCC(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(C)=O)[C@H](C(O)C(O)CO)O1 |
| InChI | InChI=1S/C15H27NO9/c1-4-7(2)24-14(22)15(23)5-9(19)11(16-8(3)18)13(25-15)12(21)10(20)6-17/h7,9-13,17,19-21,23H,4-6H2,1-3H3,(H,16,18)/t7?,9-,10?,11+,12?,13+,15?/m0/s1 |
| InChIKey | HWQBSZOIVKRQCF-ZNHCSOCUSA-N |
| XLogP | -2.61 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |