About 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal
2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal (PubChem CID 175567717) has the molecular formula C11H18F3NO
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal.
Molecular Properties
| Compound Name | 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal |
| PubChem CID | 175567717 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal |
| SMILES | CC(C)(C=O)C1CCN(C(F)C(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO/c1-11(2,7-16)8-3-5-15(6-4-8)10(14)9(12)13/h7-10H,3-6H2,1-2H3 |
| InChIKey | MRTJANAQZVFIKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal?
The IUPAC name of 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal (CID 175567717) is 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal.
What is the SMILES notation for 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal?
The canonical SMILES for 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal is CC(C)(C=O)C1CCN(C(F)C(F)F)CC1.
What is the InChIKey of 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal?
The InChIKey is MRTJANAQZVFIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO/c1-11(2,7-16)8-3-5-15(6-4-8)10(14)9(12)13/h7-10H,3-6H2,1-2H3.
What are the key properties of 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal?
2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal has a molecular weight of 237.26 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[1-(1,2,2-trifluoroethyl)piperidin-4-yl]propanal is sourced from PubChem (CID 175567717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).