About 1,3-benzothiazole;1,2,3-benzoxadiazole
1,3-benzothiazole;1,2,3-benzoxadiazole (PubChem CID 175568025) has the molecular formula C13H9N3OS
and a molecular weight of 255.30 g/mol. Its IUPAC name is 1,3-benzothiazole;1,2,3-benzoxadiazole.
Molecular Properties
| Compound Name | 1,3-benzothiazole;1,2,3-benzoxadiazole |
| PubChem CID | 175568025 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 1,3-benzothiazole;1,2,3-benzoxadiazole |
| SMILES | c1ccc2onnc2c1.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C6H4N2O/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5(3-1)7-8-9-6/h1-5H;1-4H |
| InChIKey | JVJQJNSXSDTTIK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-benzothiazole;1,2,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;1,2,3-benzoxadiazole?
The IUPAC name of 1,3-benzothiazole;1,2,3-benzoxadiazole (CID 175568025) is 1,3-benzothiazole;1,2,3-benzoxadiazole.
What is the SMILES notation for 1,3-benzothiazole;1,2,3-benzoxadiazole?
The canonical SMILES for 1,3-benzothiazole;1,2,3-benzoxadiazole is c1ccc2onnc2c1.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;1,2,3-benzoxadiazole?
The InChIKey is JVJQJNSXSDTTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C6H4N2O/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-6-5(3-1)7-8-9-6/h1-5H;1-4H.
What are the key properties of 1,3-benzothiazole;1,2,3-benzoxadiazole?
1,3-benzothiazole;1,2,3-benzoxadiazole has a molecular weight of 255.30 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;1,2,3-benzoxadiazole is sourced from PubChem (CID 175568025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).