About 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid
2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid (PubChem CID 175569158) has the molecular formula C21H17F6NO3
and a molecular weight of 445.36 g/mol. Its IUPAC name is 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid.
Molecular Properties
| Compound Name | 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid |
| PubChem CID | 175569158 |
| Molecular Formula | C21H17F6NO3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid |
| SMILES | C=CC(Cc1ccc(OC)cc1/N=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C21H17F6NO3/c1-3-13(19(29)30)8-14-4-5-17(31-2)10-18(14)28-11-12-6-15(20(22,23)24)9-16(7-12)21(25,26)27/h3-7,9-11,13H,1,8H2,2H3,(H,29,30)/b28-11+ |
| InChIKey | HOWNDXMLRPHGKV-IPBVOBEMSA-N |
| XLogP | 5.91 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid?
The IUPAC name of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid (CID 175569158) is 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid.
What is the SMILES notation for 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid?
The canonical SMILES for 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid is C=CC(Cc1ccc(OC)cc1/N=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O.
What is the InChIKey of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid?
The InChIKey is HOWNDXMLRPHGKV-IPBVOBEMSA-N. The full InChI is InChI=1S/C21H17F6NO3/c1-3-13(19(29)30)8-14-4-5-17(31-2)10-18(14)28-11-12-6-15(20(22,23)24)9-16(7-12)21(25,26)27/h3-7,9-11,13H,1,8H2,2H3,(H,29,30)/b28-11+.
What are the key properties of 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid?
2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid has a molecular weight of 445.36 g/mol, XLogP of 5.91, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-methoxyphenyl]methyl]but-3-enoic acid is sourced from PubChem (CID 175569158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).